C20H22N2 — CID 135010823
9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine (PubChem CID 135010823) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine.
| Compound Name | 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine |
|---|---|
| PubChem CID | 135010823 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine |
| SMILES | C=CCNc1ccc2c(c1CC=C)c1ccccc1n2CC |
| InChI | InChI=1S/C20H22N2/c1-4-9-15-17(21-14-5-2)12-13-19-20(15)16-10-7-8-11-18(16)22(19)6-3/h4-5,7-8,10-13,21H,1-2,6,9,14H2,3H3 |
| InChIKey | OPUOYDMTQMQXNO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|