About 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine
9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine (PubChem CID 135010823) has the molecular formula C20H22N2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine.
Molecular Properties
| Compound Name | 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine |
| PubChem CID | 135010823 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine |
| SMILES | C=CCNc1ccc2c(c1CC=C)c1ccccc1n2CC |
| InChI | InChI=1S/C20H22N2/c1-4-9-15-17(21-14-5-2)12-13-19-20(15)16-10-7-8-11-18(16)22(19)6-3/h4-5,7-8,10-13,21H,1-2,6,9,14H2,3H3 |
| InChIKey | OPUOYDMTQMQXNO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine?
The IUPAC name of 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine (CID 135010823) is 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine.
What is the SMILES notation for 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine?
The canonical SMILES for 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine is C=CCNc1ccc2c(c1CC=C)c1ccccc1n2CC.
What is the InChIKey of 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine?
The InChIKey is OPUOYDMTQMQXNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2/c1-4-9-15-17(21-14-5-2)12-13-19-20(15)16-10-7-8-11-18(16)22(19)6-3/h4-5,7-8,10-13,21H,1-2,6,9,14H2,3H3.
What are the key properties of 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine?
9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine has a molecular weight of 290.41 g/mol, XLogP of 5.14, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-N,4-bis(prop-2-enyl)carbazol-3-amine is sourced from PubChem (CID 135010823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).