C18H26O6 — CID 135010833
[(1S,1'R,2R,3S,3aS,5R,5'S,6S,6aS)-2-methoxy-3,3a,6,6a-tetramethyl-3'-oxospiro[2,3,4,6-tetrahydro-1H-pentalene-5,4'-2,6-dioxabicyclo[3.1.0]hexane]-1-yl] acetate (PubChem CID 135010833) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is [(1S,1'R,2R,3S,3aS,5R,5'S,6S,6aS)-2-methoxy-3,3a,6,6a-tetramethyl-3'-oxospiro[2,3,4,6-tetrahydro-1H-pentalene-5,4'-2,6-dioxabicyclo[3.1.0]hexane]-1-yl] acetate.
| Compound Name | [(1S,1'R,2R,3S,3aS,5R,5'S,6S,6aS)-2-methoxy-3,3a,6,6a-tetramethyl-3'-oxospiro[2,3,4,6-tetrahydro-1H-pentalene-5,4'-2,6-dioxabicyclo[3.1.0]hexane]-1-yl] acetate |
|---|---|
| PubChem CID | 135010833 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | [(1S,1'R,2R,3S,3aS,5R,5'S,6S,6aS)-2-methoxy-3,3a,6,6a-tetramethyl-3'-oxospiro[2,3,4,6-tetrahydro-1H-pentalene-5,4'-2,6-dioxabicyclo[3.1.0]hexane]-1-yl] acetate |
| SMILES | CO[C@H]1[C@@H](OC(C)=O)[C@@]2(C)[C@H](C)[C@@]3(C[C@@]2(C)[C@@H]1C)C(=O)O[C@H]1O[C@H]13 |
| InChI | InChI=1S/C18H26O6/c1-8-11(21-6)12(22-10(3)19)17(5)9(2)18(7-16(8,17)4)13-14(23-13)24-15(18)20/h8-9,11-14H,7H2,1-6H3/t8-,9+,11-,12-,13-,14-,16+,17-,18-/m1/s1 |
| InChIKey | FNSFKPVTZHOGMQ-WVMDUCAPSA-N |
| XLogP | 1.90 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|