About (Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate
(Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate (PubChem CID 135010851) has the molecular formula C14H20FO6-
and a molecular weight of 303.31 g/mol. Its IUPAC name is (Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate.
Molecular Properties
| Compound Name | (Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate |
| PubChem CID | 135010851 |
| Molecular Formula | C14H20FO6- |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate |
| SMILES | CCOC(=O)CC(=O)CCC(C(=O)OCC)/C([O-])=C/CF |
| InChI | InChI=1S/C14H21FO6/c1-3-20-13(18)9-10(16)5-6-11(12(17)7-8-15)14(19)21-4-2/h7,11,17H,3-6,8-9H2,1-2H3/p-1/b12-7- |
| InChIKey | RDJZLVCKYCOORL-GHXNOFRVSA-M |
| XLogP | 0.68 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate?
The IUPAC name of (Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate (CID 135010851) is (Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate.
What is the SMILES notation for (Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate?
The canonical SMILES for (Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate is CCOC(=O)CC(=O)CCC(C(=O)OCC)/C([O-])=C/CF.
What is the InChIKey of (Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate?
The InChIKey is RDJZLVCKYCOORL-GHXNOFRVSA-M. The full InChI is InChI=1S/C14H21FO6/c1-3-20-13(18)9-10(16)5-6-11(12(17)7-8-15)14(19)21-4-2/h7,11,17H,3-6,8-9H2,1-2H3/p-1/b12-7-.
What are the key properties of (Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate?
(Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate has a molecular weight of 303.31 g/mol, XLogP of 0.68, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-9-ethoxy-4-ethoxycarbonyl-1-fluoro-7,9-dioxonon-2-en-3-olate is sourced from PubChem (CID 135010851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).