C14H26O5 — CID 135010892
4-[(2S,3S,5R)-5-(2-methoxypropan-2-yloxy)-3-methyloxolan-2-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 135010892) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is 4-[(2S,3S,5R)-5-(2-methoxypropan-2-yloxy)-3-methyloxolan-2-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[(2S,3S,5R)-5-(2-methoxypropan-2-yloxy)-3-methyloxolan-2-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 135010892 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 4-[(2S,3S,5R)-5-(2-methoxypropan-2-yloxy)-3-methyloxolan-2-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | COC(C)(C)O[C@@H]1C[C@H](C)[C@@H](C2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C14H26O5/c1-9-7-11(19-13(2,3)15-6)17-12(9)10-8-16-14(4,5)18-10/h9-12H,7-8H2,1-6H3/t9-,10?,11+,12-/m0/s1 |
| InChIKey | RMUGBBVFXAXYLK-BEZGRXCVSA-N |
| XLogP | 2.29 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|