C16H16F3NO2 — CID 135010956
3,5-dimethoxy-4-[[4-(trifluoromethyl)phenyl]methyl]aniline (PubChem CID 135010956) has the molecular formula C16H16F3NO2 and a molecular weight of 311.30 g/mol. Its IUPAC name is 3,5-dimethoxy-4-[[4-(trifluoromethyl)phenyl]methyl]aniline.
| Compound Name | 3,5-dimethoxy-4-[[4-(trifluoromethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 135010956 |
| Molecular Formula | C16H16F3NO2 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3,5-dimethoxy-4-[[4-(trifluoromethyl)phenyl]methyl]aniline |
| SMILES | COc1cc(N)cc(OC)c1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F3NO2/c1-21-14-8-12(20)9-15(22-2)13(14)7-10-3-5-11(6-4-10)16(17,18)19/h3-6,8-9H,7,20H2,1-2H3 |
| InChIKey | APMPMHNRWONZCP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|