C15H20O6 — CID 135010976
2-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-enoyloxymethyl]prop-2-enyl prop-2-enoate (PubChem CID 135010976) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-enoyloxymethyl]prop-2-enyl prop-2-enoate.
| Compound Name | 2-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-enoyloxymethyl]prop-2-enyl prop-2-enoate |
|---|---|
| PubChem CID | 135010976 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-prop-2-enoyloxymethyl]prop-2-enyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(=C)[C@H](OC(=O)C=C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H20O6/c1-6-12(16)18-8-10(3)14(20-13(17)7-2)11-9-19-15(4,5)21-11/h6-7,11,14H,1-3,8-9H2,4-5H3/t11-,14+/m1/s1 |
| InChIKey | QZMXDFVHBSWYPY-RISCZKNCSA-N |
| XLogP | 1.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|