C49H58O9 — CID 135010980
tert-butyl (6S)-3-oxo-2-(3-oxocyclohexyl)-4,5,6,8-tetrakis(phenylmethoxy)-7-prop-2-enoxyoctanoate (PubChem CID 135010980) has the molecular formula C49H58O9 and a molecular weight of 790.99 g/mol. Its IUPAC name is tert-butyl (6S)-3-oxo-2-(3-oxocyclohexyl)-4,5,6,8-tetrakis(phenylmethoxy)-7-prop-2-enoxyoctanoate.
| Compound Name | tert-butyl (6S)-3-oxo-2-(3-oxocyclohexyl)-4,5,6,8-tetrakis(phenylmethoxy)-7-prop-2-enoxyoctanoate |
|---|---|
| PubChem CID | 135010980 |
| Molecular Formula | C49H58O9 |
| Molecular Weight | 790.99 g/mol |
| Exact Mass | 790.41 |
| IUPAC Name | tert-butyl (6S)-3-oxo-2-(3-oxocyclohexyl)-4,5,6,8-tetrakis(phenylmethoxy)-7-prop-2-enoxyoctanoate |
| SMILES | C=CCOC(COCc1ccccc1)[C@H](OCc1ccccc1)C(OCc1ccccc1)C(OCc1ccccc1)C(=O)C(C(=O)OC(C)(C)C)C1CCCC(=O)C1 |
| InChI | InChI=1S/C49H58O9/c1-5-29-54-42(35-53-31-36-19-10-6-11-20-36)45(55-32-37-21-12-7-13-22-37)47(57-34-39-25-16-9-17-26-39)46(56-33-38-23-14-8-15-24-38)44(51)43(48(52)58-49(2,3)4)40-27-18-28-41(50)30-40/h5-17,19-26,40,42-43,45-47H,1,18,27-35H2,2-4H3/t40?,42?,43?,45-,46?,47?/m0/s1 |
| InChIKey | PVPWSGVLGWLBCH-SEGSEXQHSA-N |
| XLogP | 8.82 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.99 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|