C43H50O8 — CID 135010982
tert-butyl (6S)-3-oxo-4,5,6,8-tetrakis(phenylmethoxy)-7-prop-2-enoxyoctanoate (PubChem CID 135010982) has the molecular formula C43H50O8 and a molecular weight of 694.87 g/mol. Its IUPAC name is tert-butyl (6S)-3-oxo-4,5,6,8-tetrakis(phenylmethoxy)-7-prop-2-enoxyoctanoate.
| Compound Name | tert-butyl (6S)-3-oxo-4,5,6,8-tetrakis(phenylmethoxy)-7-prop-2-enoxyoctanoate |
|---|---|
| PubChem CID | 135010982 |
| Molecular Formula | C43H50O8 |
| Molecular Weight | 694.87 g/mol |
| Exact Mass | 694.35 |
| IUPAC Name | tert-butyl (6S)-3-oxo-4,5,6,8-tetrakis(phenylmethoxy)-7-prop-2-enoxyoctanoate |
| SMILES | C=CCOC(COCc1ccccc1)[C@H](OCc1ccccc1)C(OCc1ccccc1)C(OCc1ccccc1)C(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C43H50O8/c1-5-26-47-38(32-46-28-33-18-10-6-11-19-33)41(49-30-35-22-14-8-15-23-35)42(50-31-36-24-16-9-17-25-36)40(48-29-34-20-12-7-13-21-34)37(44)27-39(45)51-43(2,3)4/h5-25,38,40-42H,1,26-32H2,2-4H3/t38?,40?,41-,42?/m0/s1 |
| InChIKey | HNCVQVPYTBXNDU-YBWWTRIQSA-N |
| XLogP | 7.83 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.87 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|