C10H8F5N — CID 135011007
3,3,4,4,4-pentafluoro-N-phenylbutan-1-imine (PubChem CID 135011007) has the molecular formula C10H8F5N and a molecular weight of 237.17 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluoro-N-phenylbutan-1-imine.
| Compound Name | 3,3,4,4,4-pentafluoro-N-phenylbutan-1-imine |
|---|---|
| PubChem CID | 135011007 |
| Molecular Formula | C10H8F5N |
| Molecular Weight | 237.17 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3,3,4,4,4-pentafluoro-N-phenylbutan-1-imine |
| SMILES | FC(F)(F)C(F)(F)C/C=N/c1ccccc1 |
| InChI | InChI=1S/C10H8F5N/c11-9(12,10(13,14)15)6-7-16-8-4-2-1-3-5-8/h1-5,7H,6H2/b16-7+ |
| InChIKey | OVICMAQBIZEYKR-FRKPEAEDSA-N |
| XLogP | 3.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.17 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|