C20H30NO7P — CID 135011066
[(3S)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl] diethyl phosphate (PubChem CID 135011066) has the molecular formula C20H30NO7P and a molecular weight of 427.43 g/mol. Its IUPAC name is [(3S)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl] diethyl phosphate.
| Compound Name | [(3S)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl] diethyl phosphate |
|---|---|
| PubChem CID | 135011066 |
| Molecular Formula | C20H30NO7P |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | [(3S)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC1=CCON(Cc2ccccc2)[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H30NO7P/c1-5-25-29(22,26-6-2)28-17-12-13-24-21(14-16-10-8-7-9-11-16)19(17)18-15-23-20(3,4)27-18/h7-12,18-19H,5-6,13-15H2,1-4H3/t18-,19-/m1/s1 |
| InChIKey | ROLXOSUCJDXYPL-RTBURBONSA-N |
| XLogP | 4.04 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|