C10H21ISi2 — CID 135011104
[(1E)-1-iodo-3-trimethylsilylbuta-1,3-dien-2-yl]-trimethylsilane (PubChem CID 135011104) has the molecular formula C10H21ISi2 and a molecular weight of 324.35 g/mol. Its IUPAC name is [(1E)-1-iodo-3-trimethylsilylbuta-1,3-dien-2-yl]-trimethylsilane.
| Compound Name | [(1E)-1-iodo-3-trimethylsilylbuta-1,3-dien-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 135011104 |
| Molecular Formula | C10H21ISi2 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | [(1E)-1-iodo-3-trimethylsilylbuta-1,3-dien-2-yl]-trimethylsilane |
| SMILES | C=C(/C(=C\I)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C10H21ISi2/c1-9(12(2,3)4)10(8-11)13(5,6)7/h8H,1H2,2-7H3/b10-8+ |
| InChIKey | BUOFJIOULRNGFR-CSKARUKUSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|