C26H58O6Si2 — CID 135011216
(2R,5R)-2,5-dimethoxy-1,6-bis[tri(propan-2-yl)silyloxy]hexane-3,4-diol (PubChem CID 135011216) has the molecular formula C26H58O6Si2 and a molecular weight of 522.92 g/mol. Its IUPAC name is (2R,5R)-2,5-dimethoxy-1,6-bis[tri(propan-2-yl)silyloxy]hexane-3,4-diol.
| Compound Name | (2R,5R)-2,5-dimethoxy-1,6-bis[tri(propan-2-yl)silyloxy]hexane-3,4-diol |
|---|---|
| PubChem CID | 135011216 |
| Molecular Formula | C26H58O6Si2 |
| Molecular Weight | 522.92 g/mol |
| Exact Mass | 522.38 |
| IUPAC Name | (2R,5R)-2,5-dimethoxy-1,6-bis[tri(propan-2-yl)silyloxy]hexane-3,4-diol |
| SMILES | CO[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)C(O)C(O)[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C26H58O6Si2/c1-17(2)33(18(3)4,19(5)6)31-15-23(29-13)25(27)26(28)24(30-14)16-32-34(20(7)8,21(9)10)22(11)12/h17-28H,15-16H2,1-14H3/t23-,24-,25?,26?/m1/s1 |
| InChIKey | NTWUELXKXQNPBO-TYPLQMOASA-N |
| XLogP | 6.12 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.92 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|