About (5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane
(5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane (PubChem CID 135011219) has the molecular formula C15H26
and a molecular weight of 206.37 g/mol. Its IUPAC name is (5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane.
Molecular Properties
| Compound Name | (5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane |
| PubChem CID | 135011219 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane |
| SMILES | CC(C)[C@@H]1CC2(C)CC3(C)CCC2C1C3 |
| InChI | InChI=1S/C15H26/c1-10(2)11-8-15(4)9-14(3)6-5-13(15)12(11)7-14/h10-13H,5-9H2,1-4H3/t11-,12?,13?,14?,15?/m0/s1 |
| InChIKey | WRXSTOPIVFUUIV-DYQPHDICSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane?
The IUPAC name of (5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane (CID 135011219) is (5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane.
What is the SMILES notation for (5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane?
The canonical SMILES for (5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane is CC(C)[C@@H]1CC2(C)CC3(C)CCC2C1C3.
What is the InChIKey of (5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane?
The InChIKey is WRXSTOPIVFUUIV-DYQPHDICSA-N. The full InChI is InChI=1S/C15H26/c1-10(2)11-8-15(4)9-14(3)6-5-13(15)12(11)7-14/h10-13H,5-9H2,1-4H3/t11-,12?,13?,14?,15?/m0/s1.
What are the key properties of (5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane?
(5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane has a molecular weight of 206.37 g/mol, XLogP of 4.49, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1,3-dimethyl-5-propan-2-yltricyclo[4.3.1.03,7]decane is sourced from PubChem (CID 135011219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).