C12H16O2 — CID 135011242
(3S,3aR,7aS)-3-(2-oxopropyl)-2,3,3a,6,7,7a-hexahydroinden-1-one (PubChem CID 135011242) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (3S,3aR,7aS)-3-(2-oxopropyl)-2,3,3a,6,7,7a-hexahydroinden-1-one.
| Compound Name | (3S,3aR,7aS)-3-(2-oxopropyl)-2,3,3a,6,7,7a-hexahydroinden-1-one |
|---|---|
| PubChem CID | 135011242 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (3S,3aR,7aS)-3-(2-oxopropyl)-2,3,3a,6,7,7a-hexahydroinden-1-one |
| SMILES | CC(=O)C[C@H]1CC(=O)[C@H]2CCC=C[C@@H]12 |
| InChI | InChI=1S/C12H16O2/c1-8(13)6-9-7-12(14)11-5-3-2-4-10(9)11/h2,4,9-11H,3,5-7H2,1H3/t9-,10-,11-/m0/s1 |
| InChIKey | YQCVJKARKZQBKO-DCAQKATOSA-N |
| XLogP | 2.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|