C19H29O6P — CID 135011324
(6E,8E)-9-(3,5-dimethoxyphenyl)-1-dimethoxyphosphorylnona-6,8-dien-2-ol (PubChem CID 135011324) has the molecular formula C19H29O6P and a molecular weight of 384.41 g/mol. Its IUPAC name is (6E,8E)-9-(3,5-dimethoxyphenyl)-1-dimethoxyphosphorylnona-6,8-dien-2-ol.
| Compound Name | (6E,8E)-9-(3,5-dimethoxyphenyl)-1-dimethoxyphosphorylnona-6,8-dien-2-ol |
|---|---|
| PubChem CID | 135011324 |
| Molecular Formula | C19H29O6P |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (6E,8E)-9-(3,5-dimethoxyphenyl)-1-dimethoxyphosphorylnona-6,8-dien-2-ol |
| SMILES | COc1cc(/C=C/C=C/CCCC(O)CP(=O)(OC)OC)cc(OC)c1 |
| InChI | InChI=1S/C19H29O6P/c1-22-18-12-16(13-19(14-18)23-2)10-8-6-5-7-9-11-17(20)15-26(21,24-3)25-4/h5-6,8,10,12-14,17,20H,7,9,11,15H2,1-4H3/b6-5+,10-8+ |
| InChIKey | VQZCGUHKSHNKKL-FTKIWFIZSA-N |
| XLogP | 4.29 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|