C22H35FO4 — CID 135011332
diethyl 4-[(1R)-1-fluorodecyl]cyclohexa-1,4-diene-1,2-dicarboxylate (PubChem CID 135011332) has the molecular formula C22H35FO4 and a molecular weight of 382.52 g/mol. Its IUPAC name is diethyl 4-[(1R)-1-fluorodecyl]cyclohexa-1,4-diene-1,2-dicarboxylate.
| Compound Name | diethyl 4-[(1R)-1-fluorodecyl]cyclohexa-1,4-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 135011332 |
| Molecular Formula | C22H35FO4 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | diethyl 4-[(1R)-1-fluorodecyl]cyclohexa-1,4-diene-1,2-dicarboxylate |
| SMILES | CCCCCCCCC[C@@H](F)C1=CCC(C(=O)OCC)=C(C(=O)OCC)C1 |
| InChI | InChI=1S/C22H35FO4/c1-4-7-8-9-10-11-12-13-20(23)17-14-15-18(21(24)26-5-2)19(16-17)22(25)27-6-3/h14,20H,4-13,15-16H2,1-3H3/t20-/m1/s1 |
| InChIKey | LYQGGQJGRMSOMA-HXUWFJFHSA-N |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|