C17H20N2O4 — CID 135011336
dimethyl (2R,3S)-1-[3-(methylamino)-2-pyridinyl]bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 135011336) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is dimethyl (2R,3S)-1-[3-(methylamino)-2-pyridinyl]bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dimethyl (2R,3S)-1-[3-(methylamino)-2-pyridinyl]bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 135011336 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | dimethyl (2R,3S)-1-[3-(methylamino)-2-pyridinyl]bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CNc1cccnc1C12C=CC(C1)[C@H](C(=O)OC)[C@H]2C(=O)OC |
| InChI | InChI=1S/C17H20N2O4/c1-18-11-5-4-8-19-14(11)17-7-6-10(9-17)12(15(20)22-2)13(17)16(21)23-3/h4-8,10,12-13,18H,9H2,1-3H3/t10?,12-,13-,17?/m0/s1 |
| InChIKey | QGZSDFQDPQKRKL-RILABDALSA-N |
| XLogP | 1.53 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|