C10H12O3 — CID 135011406
(2R,4Z,6E)-2-methyl-2,3-dihydrooxecine-8,10-dione (PubChem CID 135011406) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (2R,4Z,6E)-2-methyl-2,3-dihydrooxecine-8,10-dione.
| Compound Name | (2R,4Z,6E)-2-methyl-2,3-dihydrooxecine-8,10-dione |
|---|---|
| PubChem CID | 135011406 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (2R,4Z,6E)-2-methyl-2,3-dihydrooxecine-8,10-dione |
| SMILES | C[C@@H]1C/C=C\C=C\C(=O)CC(=O)O1 |
| InChI | InChI=1S/C10H12O3/c1-8-5-3-2-4-6-9(11)7-10(12)13-8/h2-4,6,8H,5,7H2,1H3/b3-2-,6-4+/t8-/m1/s1 |
| InChIKey | ATNQPBLKBJJYFA-UEEASKOISA-N |
| XLogP | 1.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|