C17H16O3 — CID 135011459
1-(6-prop-2-enoyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecan-4-yl)prop-2-en-1-one (PubChem CID 135011459) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-(6-prop-2-enoyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecan-4-yl)prop-2-en-1-one.
| Compound Name | 1-(6-prop-2-enoyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecan-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 135011459 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-(6-prop-2-enoyl-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecan-4-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)C12OC3(C(=O)C=C)C4C5CC(C6C5C3C61)C42 |
| InChI | InChI=1S/C17H16O3/c1-3-8(18)16-12-6-5-7-11-10(6)14(16)15(11)17(20-16,13(7)12)9(19)4-2/h3-4,6-7,10-15H,1-2,5H2 |
| InChIKey | RYQIKXBOSFNFRJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|