C19H29N — CID 135011462
N-[(7,8,9,10-tetramethyl-1-tricyclo[4.2.2.22,5]dodeca-3,7,11-trienyl)methyl]ethanamine (PubChem CID 135011462) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is N-[(7,8,9,10-tetramethyl-1-tricyclo[4.2.2.22,5]dodeca-3,7,11-trienyl)methyl]ethanamine.
| Compound Name | N-[(7,8,9,10-tetramethyl-1-tricyclo[4.2.2.22,5]dodeca-3,7,11-trienyl)methyl]ethanamine |
|---|---|
| PubChem CID | 135011462 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-[(7,8,9,10-tetramethyl-1-tricyclo[4.2.2.22,5]dodeca-3,7,11-trienyl)methyl]ethanamine |
| SMILES | CCNCC12C(C)=C(C)C(C3C=CC1C=C3)C(C)C2C |
| InChI | InChI=1S/C19H29N/c1-6-20-11-19-14(4)12(2)18(13(3)15(19)5)16-7-9-17(19)10-8-16/h7-10,12,14,16-18,20H,6,11H2,1-5H3 |
| InChIKey | QALKGGCCRJNZKS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|