C20H30BNO2 — CID 135011496
(8Z)-8-[(2E)-3-methyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]butylidene]-6,7-dihydro-5H-indolizine (PubChem CID 135011496) has the molecular formula C20H30BNO2 and a molecular weight of 327.28 g/mol. Its IUPAC name is (8Z)-8-[(2E)-3-methyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]butylidene]-6,7-dihydro-5H-indolizine.
| Compound Name | (8Z)-8-[(2E)-3-methyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]butylidene]-6,7-dihydro-5H-indolizine |
|---|---|
| PubChem CID | 135011496 |
| Molecular Formula | C20H30BNO2 |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | (8Z)-8-[(2E)-3-methyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]butylidene]-6,7-dihydro-5H-indolizine |
| SMILES | CC(C)C(/C=C1/CCCn2cccc21)=C\B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H30BNO2/c1-15(2)17(14-21-23-19(3,4)20(5,6)24-21)13-16-9-7-11-22-12-8-10-18(16)22/h8,10,12-15H,7,9,11H2,1-6H3/b16-13-,17-14- |
| InChIKey | RQPUCFPLAPZPOD-YKVSKMSXSA-N |
| XLogP | 4.88 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|