C14H18O2 — CID 135011505
9-(hydroxymethyl)-1,10-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one (PubChem CID 135011505) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 9-(hydroxymethyl)-1,10-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one.
| Compound Name | 9-(hydroxymethyl)-1,10-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
|---|---|
| PubChem CID | 135011505 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 9-(hydroxymethyl)-1,10-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
| SMILES | CC1=CC2C(=O)C(CO)C1(C)C1CC=CC21 |
| InChI | InChI=1S/C14H18O2/c1-8-6-10-9-4-3-5-11(9)14(8,2)12(7-15)13(10)16/h3-4,6,9-12,15H,5,7H2,1-2H3 |
| InChIKey | QYVFLTPUZZVYOO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|