C19H30O3 — CID 135011668
ethyl 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-oxocyclohexane-1-carboxylate (PubChem CID 135011668) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is ethyl 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-oxocyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 135011668 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | ethyl 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-oxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(C/C=C(\C)CCC=C(C)C)CCCCC1=O |
| InChI | InChI=1S/C19H30O3/c1-5-22-18(21)19(13-7-6-11-17(19)20)14-12-16(4)10-8-9-15(2)3/h9,12H,5-8,10-11,13-14H2,1-4H3/b16-12+ |
| InChIKey | YGZKYOYTTRKGOF-FOWTUZBSSA-N |
| XLogP | 4.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|