C18H26NO4P — CID 135011677
[[2-(cyclohexen-1-yl)-1-phenylethylidene]amino] diethyl phosphate (PubChem CID 135011677) has the molecular formula C18H26NO4P and a molecular weight of 351.38 g/mol. Its IUPAC name is [[2-(cyclohexen-1-yl)-1-phenylethylidene]amino] diethyl phosphate.
| Compound Name | [[2-(cyclohexen-1-yl)-1-phenylethylidene]amino] diethyl phosphate |
|---|---|
| PubChem CID | 135011677 |
| Molecular Formula | C18H26NO4P |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [[2-(cyclohexen-1-yl)-1-phenylethylidene]amino] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)ON=C(CC1=CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H26NO4P/c1-3-21-24(20,22-4-2)23-19-18(17-13-9-6-10-14-17)15-16-11-7-5-8-12-16/h6,9-11,13-14H,3-5,7-8,12,15H2,1-2H3 |
| InChIKey | HMIZVZQHYCGMFH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|