C18H20O4 — CID 135011837
(3Z)-3-[(2E,4E,6E,8E)-1-hydroxy-2,6,8-trimethyldeca-2,4,6,8-tetraenylidene]-5-methylideneoxolane-2,4-dione (PubChem CID 135011837) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (3Z)-3-[(2E,4E,6E,8E)-1-hydroxy-2,6,8-trimethyldeca-2,4,6,8-tetraenylidene]-5-methylideneoxolane-2,4-dione.
| Compound Name | (3Z)-3-[(2E,4E,6E,8E)-1-hydroxy-2,6,8-trimethyldeca-2,4,6,8-tetraenylidene]-5-methylideneoxolane-2,4-dione |
|---|---|
| PubChem CID | 135011837 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (3Z)-3-[(2E,4E,6E,8E)-1-hydroxy-2,6,8-trimethyldeca-2,4,6,8-tetraenylidene]-5-methylideneoxolane-2,4-dione |
| SMILES | C=C1OC(=O)/C(=C(O)/C(C)=C/C=C/C(C)=C/C(C)=C/C)C1=O |
| InChI | InChI=1S/C18H20O4/c1-6-11(2)10-12(3)8-7-9-13(4)16(19)15-17(20)14(5)22-18(15)21/h6-10,19H,5H2,1-4H3/b8-7+,11-6+,12-10+,13-9+,16-15- |
| InChIKey | LMVFCUKXASADJV-GRVUFKPESA-N |
| XLogP | 3.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|