C10H16O — CID 135011847
(2E,4E,6E)-4,6-dimethylocta-2,4,6-trien-1-ol (PubChem CID 135011847) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (2E,4E,6E)-4,6-dimethylocta-2,4,6-trien-1-ol.
| Compound Name | (2E,4E,6E)-4,6-dimethylocta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 135011847 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2E,4E,6E)-4,6-dimethylocta-2,4,6-trien-1-ol |
| SMILES | C/C=C(C)/C=C(C)/C=C/CO |
| InChI | InChI=1S/C10H16O/c1-4-9(2)8-10(3)6-5-7-11/h4-6,8,11H,7H2,1-3H3/b6-5+,9-4+,10-8+ |
| InChIKey | ZAMJIXWFIWYUQZ-SNSGOBCESA-N |
| XLogP | 2.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|