C17H16O3S — CID 135012045
methyl (2R,3S)-2-formyl-3-phenyl-3-phenylsulfanylpropanoate (PubChem CID 135012045) has the molecular formula C17H16O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is methyl (2R,3S)-2-formyl-3-phenyl-3-phenylsulfanylpropanoate.
| Compound Name | methyl (2R,3S)-2-formyl-3-phenyl-3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 135012045 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | methyl (2R,3S)-2-formyl-3-phenyl-3-phenylsulfanylpropanoate |
| SMILES | COC(=O)[C@@H](C=O)[C@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16O3S/c1-20-17(19)15(12-18)16(13-8-4-2-5-9-13)21-14-10-6-3-7-11-14/h2-12,15-16H,1H3/t15-,16+/m0/s1 |
| InChIKey | NOLZDIRHUMKWLW-JKSUJKDBSA-N |
| XLogP | 3.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|