C32H34NO2+ — CID 135012133
(3S,4S)-1,1-dibenzyl-3,4-bis(phenylmethoxy)pyrrolidin-1-ium (PubChem CID 135012133) has the molecular formula C32H34NO2+ and a molecular weight of 464.63 g/mol. Its IUPAC name is (3S,4S)-1,1-dibenzyl-3,4-bis(phenylmethoxy)pyrrolidin-1-ium.
| Compound Name | (3S,4S)-1,1-dibenzyl-3,4-bis(phenylmethoxy)pyrrolidin-1-ium |
|---|---|
| PubChem CID | 135012133 |
| Molecular Formula | C32H34NO2+ |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | (3S,4S)-1,1-dibenzyl-3,4-bis(phenylmethoxy)pyrrolidin-1-ium |
| SMILES | c1ccc(CO[C@H]2C[N+](Cc3ccccc3)(Cc3ccccc3)C[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H34NO2/c1-5-13-27(14-6-1)21-33(22-28-15-7-2-8-16-28)23-31(34-25-29-17-9-3-10-18-29)32(24-33)35-26-30-19-11-4-12-20-30/h1-20,31-32H,21-26H2/q+1/t31-,32-/m0/s1 |
| InChIKey | VJRXOBLNZILBDP-ACHIHNKUSA-N |
| XLogP | 6.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|