C26H38N4O2Si2 — CID 135012146
trimethyl-[2-[[5-[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]indazol-1-yl]methoxy]ethyl]silane (PubChem CID 135012146) has the molecular formula C26H38N4O2Si2 and a molecular weight of 494.79 g/mol. Its IUPAC name is trimethyl-[2-[[5-[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]indazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]indazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 135012146 |
| Molecular Formula | C26H38N4O2Si2 |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | trimethyl-[2-[[5-[1-(2-trimethylsilylethoxymethyl)indazol-5-yl]indazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ncc2cc(-c3ccc4c(cnn4COCC[Si](C)(C)C)c3)ccc21 |
| InChI | InChI=1S/C26H38N4O2Si2/c1-33(2,3)13-11-31-19-29-25-9-7-21(15-23(25)17-27-29)22-8-10-26-24(16-22)18-28-30(26)20-32-12-14-34(4,5)6/h7-10,15-18H,11-14,19-20H2,1-6H3 |
| InChIKey | WXFJUOOPOAJNQQ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|