C18H25NO — CID 135012152
(1R,2R,9aR)-9-ethenyl-1,2,3,4,6,8-hexamethyl-2,9a-dihydroquinolizine-1-carbaldehyde (PubChem CID 135012152) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (1R,2R,9aR)-9-ethenyl-1,2,3,4,6,8-hexamethyl-2,9a-dihydroquinolizine-1-carbaldehyde.
| Compound Name | (1R,2R,9aR)-9-ethenyl-1,2,3,4,6,8-hexamethyl-2,9a-dihydroquinolizine-1-carbaldehyde |
|---|---|
| PubChem CID | 135012152 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (1R,2R,9aR)-9-ethenyl-1,2,3,4,6,8-hexamethyl-2,9a-dihydroquinolizine-1-carbaldehyde |
| SMILES | C=CC1=C(C)C=C(C)N2C(C)=C(C)[C@@H](C)[C@@](C)(C=O)[C@@H]12 |
| InChI | InChI=1S/C18H25NO/c1-8-16-11(2)9-12(3)19-15(6)13(4)14(5)18(7,10-20)17(16)19/h8-10,14,17H,1H2,2-7H3/t14-,17-,18-/m1/s1 |
| InChIKey | KLLQFBGHBKOZRL-ZTFGCOKTSA-N |
| XLogP | 4.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|