About ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate
ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate (PubChem CID 135012503) has the molecular formula C16H18ClF3N2O3
and a molecular weight of 378.78 g/mol. Its IUPAC name is ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate |
| PubChem CID | 135012503 |
| Molecular Formula | C16H18ClF3N2O3 |
| Molecular Weight | 378.78 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1[C@@H](c2ccc(Cl)nc2)CC(C(F)(F)F)N1C(C)=O |
| InChI | InChI=1S/C16H18ClF3N2O3/c1-3-25-15(24)7-12-11(10-4-5-14(17)21-8-10)6-13(16(18,19)20)22(12)9(2)23/h4-5,8,11-13H,3,6-7H2,1-2H3/t11-,12-,13?/m1/s1 |
| InChIKey | GQVZKILOAVZVMX-ZNRZSNADSA-N |
| XLogP | 3.32 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.78 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate?
The IUPAC name of ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate (CID 135012503) is ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate.
What is the SMILES notation for ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate?
The canonical SMILES for ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate is CCOC(=O)C[C@@H]1[C@@H](c2ccc(Cl)nc2)CC(C(F)(F)F)N1C(C)=O.
What is the InChIKey of ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate?
The InChIKey is GQVZKILOAVZVMX-ZNRZSNADSA-N. The full InChI is InChI=1S/C16H18ClF3N2O3/c1-3-25-15(24)7-12-11(10-4-5-14(17)21-8-10)6-13(16(18,19)20)22(12)9(2)23/h4-5,8,11-13H,3,6-7H2,1-2H3/t11-,12-,13?/m1/s1.
What are the key properties of ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate?
ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate has a molecular weight of 378.78 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2R,3R)-1-acetyl-3-(6-chloro-3-pyridinyl)-5-(trifluoromethyl)pyrrolidin-2-yl]acetate is sourced from PubChem (CID 135012503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).