C18H20N4S2 — CID 135012678
3,6-bis(2-phenylsulfanylethyl)-1,4-dihydro-1,2,4,5-tetrazine (PubChem CID 135012678) has the molecular formula C18H20N4S2 and a molecular weight of 356.52 g/mol. Its IUPAC name is 3,6-bis(2-phenylsulfanylethyl)-1,4-dihydro-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis(2-phenylsulfanylethyl)-1,4-dihydro-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 135012678 |
| Molecular Formula | C18H20N4S2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 3,6-bis(2-phenylsulfanylethyl)-1,4-dihydro-1,2,4,5-tetrazine |
| SMILES | c1ccc(SCCC2=NNC(CCSc3ccccc3)=NN2)cc1 |
| InChI | InChI=1S/C18H20N4S2/c1-3-7-15(8-4-1)23-13-11-17-19-21-18(22-20-17)12-14-24-16-9-5-2-6-10-16/h1-10H,11-14H2,(H,19,20)(H,21,22) |
| InChIKey | LZQYOPBGIWRPIM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |