C18H20N4S2 — CID 135012679
3,5-bis(2-phenylsulfanylethyl)-1,2,4-triazol-4-amine (PubChem CID 135012679) has the molecular formula C18H20N4S2 and a molecular weight of 356.52 g/mol. Its IUPAC name is 3,5-bis(2-phenylsulfanylethyl)-1,2,4-triazol-4-amine.
| Compound Name | 3,5-bis(2-phenylsulfanylethyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 135012679 |
| Molecular Formula | C18H20N4S2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 3,5-bis(2-phenylsulfanylethyl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(CCSc2ccccc2)nnc1CCSc1ccccc1 |
| InChI | InChI=1S/C18H20N4S2/c19-22-17(11-13-23-15-7-3-1-4-8-15)20-21-18(22)12-14-24-16-9-5-2-6-10-16/h1-10H,11-14,19H2 |
| InChIKey | KHEQMZKPFJVVIV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |