About (2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one
(2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one (PubChem CID 135012815) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | (2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one |
| PubChem CID | 135012815 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one |
| SMILES | CCC/C=C/[C@@H]1OC(=O)C=C[C@@H]1C |
| InChI | InChI=1S/C11H16O2/c1-3-4-5-6-10-9(2)7-8-11(12)13-10/h5-10H,3-4H2,1-2H3/b6-5+/t9-,10-/m0/s1 |
| InChIKey | UDXBJVNQRZVDAN-QEBMPYFUSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one?
The IUPAC name of (2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one (CID 135012815) is (2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one.
What is the SMILES notation for (2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one?
The canonical SMILES for (2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one is CCC/C=C/[C@@H]1OC(=O)C=C[C@@H]1C.
What is the InChIKey of (2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one?
The InChIKey is UDXBJVNQRZVDAN-QEBMPYFUSA-N. The full InChI is InChI=1S/C11H16O2/c1-3-4-5-6-10-9(2)7-8-11(12)13-10/h5-10H,3-4H2,1-2H3/b6-5+/t9-,10-/m0/s1.
What are the key properties of (2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one?
(2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one has a molecular weight of 180.25 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-methyl-2-[(E)-pent-1-enyl]-2,3-dihydropyran-6-one is sourced from PubChem (CID 135012815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).