C19H19NO3 — CID 135012878
(1-acetyl-6-methyl-3-phenyl-2,3-dihydroindol-4-yl) acetate (PubChem CID 135012878) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (1-acetyl-6-methyl-3-phenyl-2,3-dihydroindol-4-yl) acetate.
| Compound Name | (1-acetyl-6-methyl-3-phenyl-2,3-dihydroindol-4-yl) acetate |
|---|---|
| PubChem CID | 135012878 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (1-acetyl-6-methyl-3-phenyl-2,3-dihydroindol-4-yl) acetate |
| SMILES | CC(=O)Oc1cc(C)cc2c1C(c1ccccc1)CN2C(C)=O |
| InChI | InChI=1S/C19H19NO3/c1-12-9-17-19(18(10-12)23-14(3)22)16(11-20(17)13(2)21)15-7-5-4-6-8-15/h4-10,16H,11H2,1-3H3 |
| InChIKey | AXNNJONTGDRIBG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|