C18H28O — CID 135012884
(1R,3Z,6Z,9R,11S,12S,14S)-3-ethenyl-11,12,14-trimethyl-2-oxabicyclo[7.5.0]tetradeca-3,6-diene (PubChem CID 135012884) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is (1R,3Z,6Z,9R,11S,12S,14S)-3-ethenyl-11,12,14-trimethyl-2-oxabicyclo[7.5.0]tetradeca-3,6-diene.
| Compound Name | (1R,3Z,6Z,9R,11S,12S,14S)-3-ethenyl-11,12,14-trimethyl-2-oxabicyclo[7.5.0]tetradeca-3,6-diene |
|---|---|
| PubChem CID | 135012884 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | (1R,3Z,6Z,9R,11S,12S,14S)-3-ethenyl-11,12,14-trimethyl-2-oxabicyclo[7.5.0]tetradeca-3,6-diene |
| SMILES | C=C/C1=C/C/C=C\C[C@@H]2C[C@H](C)[C@@H](C)C[C@H](C)[C@H]2O1 |
| InChI | InChI=1S/C18H28O/c1-5-17-10-8-6-7-9-16-12-14(3)13(2)11-15(4)18(16)19-17/h5-7,10,13-16,18H,1,8-9,11-12H2,2-4H3/b7-6-,17-10-/t13-,14-,15-,16+,18+/m0/s1 |
| InChIKey | KTFAIQYHZFJXAM-BIARCDLRSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|