C17H29NO3Si — CID 135012952
(3S)-N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybutan-1-imine oxide (PubChem CID 135012952) has the molecular formula C17H29NO3Si and a molecular weight of 323.51 g/mol. Its IUPAC name is (3S)-N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybutan-1-imine oxide.
| Compound Name | (3S)-N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybutan-1-imine oxide |
|---|---|
| PubChem CID | 135012952 |
| Molecular Formula | C17H29NO3Si |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (3S)-N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybutan-1-imine oxide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CO)C/C=[N+](\[O-])Cc1ccccc1 |
| InChI | InChI=1S/C17H29NO3Si/c1-17(2,3)22(4,5)21-16(14-19)11-12-18(20)13-15-9-7-6-8-10-15/h6-10,12,16,19H,11,13-14H2,1-5H3/b18-12-/t16-/m0/s1 |
| InChIKey | MXSYLGQZXMRSIN-JIHKLPAASA-N |
| XLogP | 3.54 |
| TPSA | 55.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|