About 2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane
2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane (PubChem CID 135013034) has the molecular formula C9H14OS2
and a molecular weight of 202.34 g/mol. Its IUPAC name is 2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane.
Molecular Properties
| Compound Name | 2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane |
| PubChem CID | 135013034 |
| Molecular Formula | C9H14OS2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane |
| SMILES | C=C/C=C(\OC)C1SCCCS1 |
| InChI | InChI=1S/C9H14OS2/c1-3-5-8(10-2)9-11-6-4-7-12-9/h3,5,9H,1,4,6-7H2,2H3/b8-5- |
| InChIKey | RFXYPQGGWKCXRG-YVMONPNESA-N |
| XLogP | 2.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane?
The IUPAC name of 2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane (CID 135013034) is 2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane.
What is the SMILES notation for 2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane?
The canonical SMILES for 2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane is C=C/C=C(\OC)C1SCCCS1.
What is the InChIKey of 2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane?
The InChIKey is RFXYPQGGWKCXRG-YVMONPNESA-N. The full InChI is InChI=1S/C9H14OS2/c1-3-5-8(10-2)9-11-6-4-7-12-9/h3,5,9H,1,4,6-7H2,2H3/b8-5-.
What are the key properties of 2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane?
2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane has a molecular weight of 202.34 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z)-1-methoxybuta-1,3-dienyl]-1,3-dithiane is sourced from PubChem (CID 135013034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).