C14H15F3N2O6 — CID 135013184
N-[2-[(Z)-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-ylidene]methyl]-4-methoxy-3-pyridinyl]-2,2,2-trifluoroacetamide (PubChem CID 135013184) has the molecular formula C14H15F3N2O6 and a molecular weight of 364.28 g/mol. Its IUPAC name is N-[2-[(Z)-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-ylidene]methyl]-4-methoxy-3-pyridinyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[(Z)-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-ylidene]methyl]-4-methoxy-3-pyridinyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 135013184 |
| Molecular Formula | C14H15F3N2O6 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-[2-[(Z)-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-ylidene]methyl]-4-methoxy-3-pyridinyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccnc(/C=C2\O[C@H](CO)[C@@H](O)[C@H]2O)c1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O6/c1-24-7-2-3-18-6(10(7)19-13(23)14(15,16)17)4-8-11(21)12(22)9(5-20)25-8/h2-4,9,11-12,20-22H,5H2,1H3,(H,19,23)/b8-4-/t9-,11+,12-/m1/s1 |
| InChIKey | DGSIAIBKGXZVCK-OXZPSPPRSA-N |
| XLogP | 0.04 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |