C30H40N4O2 — CID 135013349
2-[15-(2-hydroxyethyl)-5,10,10,15,20,20-hexamethyl-21,22,23,24-tetrahydroporphyrin-5-yl]ethanol (PubChem CID 135013349) has the molecular formula C30H40N4O2 and a molecular weight of 488.68 g/mol. Its IUPAC name is 2-[15-(2-hydroxyethyl)-5,10,10,15,20,20-hexamethyl-21,22,23,24-tetrahydroporphyrin-5-yl]ethanol.
| Compound Name | 2-[15-(2-hydroxyethyl)-5,10,10,15,20,20-hexamethyl-21,22,23,24-tetrahydroporphyrin-5-yl]ethanol |
|---|---|
| PubChem CID | 135013349 |
| Molecular Formula | C30H40N4O2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | 2-[15-(2-hydroxyethyl)-5,10,10,15,20,20-hexamethyl-21,22,23,24-tetrahydroporphyrin-5-yl]ethanol |
| SMILES | CC1(C)c2ccc([nH]2)C(C)(CCO)c2ccc([nH]2)C(C)(C)c2ccc([nH]2)C(C)(CCO)c2ccc1[nH]2 |
| InChI | InChI=1S/C30H40N4O2/c1-27(2)19-7-11-23(31-19)29(5,15-17-35)25-13-9-21(33-25)28(3,4)22-10-14-26(34-22)30(6,16-18-36)24-12-8-20(27)32-24/h7-14,31-36H,15-18H2,1-6H3 |
| InChIKey | VYHABBPKTCBNKX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |