C16H23NO3 — CID 135013434
(2S,4R,5R)-4-[(2R)-1-benzylpyrrolidin-2-yl]-2-methyl-1,3-dioxan-5-ol (PubChem CID 135013434) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (2S,4R,5R)-4-[(2R)-1-benzylpyrrolidin-2-yl]-2-methyl-1,3-dioxan-5-ol.
| Compound Name | (2S,4R,5R)-4-[(2R)-1-benzylpyrrolidin-2-yl]-2-methyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 135013434 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (2S,4R,5R)-4-[(2R)-1-benzylpyrrolidin-2-yl]-2-methyl-1,3-dioxan-5-ol |
| SMILES | C[C@H]1OC[C@@H](O)[C@@H]([C@H]2CCCN2Cc2ccccc2)O1 |
| InChI | InChI=1S/C16H23NO3/c1-12-19-11-15(18)16(20-12)14-8-5-9-17(14)10-13-6-3-2-4-7-13/h2-4,6-7,12,14-16,18H,5,8-11H2,1H3/t12-,14+,15+,16+/m0/s1 |
| InChIKey | HKJVTVSDTIQMJB-LCGIIJARSA-N |
| XLogP | 1.77 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |