C16H14F3OS2+ — CID 135013504
[1,1,1-trifluoro-4,4-bis(phenylsulfanyl)butan-2-ylidene]oxidanium (PubChem CID 135013504) has the molecular formula C16H14F3OS2+ and a molecular weight of 343.42 g/mol. Its IUPAC name is [1,1,1-trifluoro-4,4-bis(phenylsulfanyl)butan-2-ylidene]oxidanium.
| Compound Name | [1,1,1-trifluoro-4,4-bis(phenylsulfanyl)butan-2-ylidene]oxidanium |
|---|---|
| PubChem CID | 135013504 |
| Molecular Formula | C16H14F3OS2+ |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | [1,1,1-trifluoro-4,4-bis(phenylsulfanyl)butan-2-ylidene]oxidanium |
| SMILES | [H]/[O+]=C(/CC(Sc1ccccc1)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H13F3OS2/c17-16(18,19)14(20)11-15(21-12-7-3-1-4-8-12)22-13-9-5-2-6-10-13/h1-10,15H,11H2/p+1 |
| InChIKey | MQXZNENFXWRHHA-UHFFFAOYSA-O |
| XLogP | 5.39 |
| TPSA | 21.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|