About 2,2,4-triphenyl-5H-1,3-oxazole
2,2,4-triphenyl-5H-1,3-oxazole (PubChem CID 135013782) has the molecular formula C21H17NO
and a molecular weight of 299.37 g/mol. Its IUPAC name is 2,2,4-triphenyl-5H-1,3-oxazole.
Molecular Properties
| Compound Name | 2,2,4-triphenyl-5H-1,3-oxazole |
| PubChem CID | 135013782 |
| Molecular Formula | C21H17NO |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2,2,4-triphenyl-5H-1,3-oxazole |
| SMILES | c1ccc(C2=NC(c3ccccc3)(c3ccccc3)OC2)cc1 |
| InChI | InChI=1S/C21H17NO/c1-4-10-17(11-5-1)20-16-23-21(22-20,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H,16H2 |
| InChIKey | BDUMMBPOANEIHM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2,4-triphenyl-5H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,4-triphenyl-5H-1,3-oxazole?
The IUPAC name of 2,2,4-triphenyl-5H-1,3-oxazole (CID 135013782) is 2,2,4-triphenyl-5H-1,3-oxazole.
What is the SMILES notation for 2,2,4-triphenyl-5H-1,3-oxazole?
The canonical SMILES for 2,2,4-triphenyl-5H-1,3-oxazole is c1ccc(C2=NC(c3ccccc3)(c3ccccc3)OC2)cc1.
What is the InChIKey of 2,2,4-triphenyl-5H-1,3-oxazole?
The InChIKey is BDUMMBPOANEIHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO/c1-4-10-17(11-5-1)20-16-23-21(22-20,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H,16H2.
What are the key properties of 2,2,4-triphenyl-5H-1,3-oxazole?
2,2,4-triphenyl-5H-1,3-oxazole has a molecular weight of 299.37 g/mol, XLogP of 4.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,4-triphenyl-5H-1,3-oxazole is sourced from PubChem (CID 135013782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).