C22H32O3 — CID 135013794
(5R)-4-methoxy-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 135013794) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (5R)-4-methoxy-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (5R)-4-methoxy-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 135013794 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (5R)-4-methoxy-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | COC1=CC(=O)C2(CC=C(C)C)CC(CC=C(C)C)C(C)(C)[C@H]1C2=O |
| InChI | InChI=1S/C22H32O3/c1-14(2)8-9-16-13-22(11-10-15(3)4)18(23)12-17(25-7)19(20(22)24)21(16,5)6/h8,10,12,16,19H,9,11,13H2,1-7H3/t16?,19-,22?/m1/s1 |
| InChIKey | XWRCJKAFJXWDOK-COFLGROHSA-N |
| XLogP | 5.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|