C22H40O5Si — CID 135013816
tert-butyl (1S,3R,6S,9R)-6-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyl-4-oxo-10-oxabicyclo[7.1.0]decane-3-carboxylate (PubChem CID 135013816) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is tert-butyl (1S,3R,6S,9R)-6-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyl-4-oxo-10-oxabicyclo[7.1.0]decane-3-carboxylate.
| Compound Name | tert-butyl (1S,3R,6S,9R)-6-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyl-4-oxo-10-oxabicyclo[7.1.0]decane-3-carboxylate |
|---|---|
| PubChem CID | 135013816 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | tert-butyl (1S,3R,6S,9R)-6-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyl-4-oxo-10-oxabicyclo[7.1.0]decane-3-carboxylate |
| SMILES | CC1C(=O)[C@H](C(=O)OC(C)(C)C)C[C@@H]2O[C@]2(C)CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O5Si/c1-14-16(27-28(9,10)21(5,6)7)11-12-22(8)17(25-22)13-15(18(14)23)19(24)26-20(2,3)4/h14-17H,11-13H2,1-10H3/t14?,15-,16+,17+,22-/m1/s1 |
| InChIKey | KMCAKPYTTWIJRL-FDZVYFAPSA-N |
| XLogP | 4.88 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|