C18H28O8 — CID 135013877
[(6R,6aS,8R,9R,10aS,10bR)-8,9-dimethoxy-2,2,8,9-tetramethyl-6,6a,10a,10b-tetrahydro-4H-[1,4]dioxino[2,3-h][1,3]benzodioxin-6-yl] acetate (PubChem CID 135013877) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is [(6R,6aS,8R,9R,10aS,10bR)-8,9-dimethoxy-2,2,8,9-tetramethyl-6,6a,10a,10b-tetrahydro-4H-[1,4]dioxino[2,3-h][1,3]benzodioxin-6-yl] acetate.
| Compound Name | [(6R,6aS,8R,9R,10aS,10bR)-8,9-dimethoxy-2,2,8,9-tetramethyl-6,6a,10a,10b-tetrahydro-4H-[1,4]dioxino[2,3-h][1,3]benzodioxin-6-yl] acetate |
|---|---|
| PubChem CID | 135013877 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | [(6R,6aS,8R,9R,10aS,10bR)-8,9-dimethoxy-2,2,8,9-tetramethyl-6,6a,10a,10b-tetrahydro-4H-[1,4]dioxino[2,3-h][1,3]benzodioxin-6-yl] acetate |
| SMILES | CO[C@]1(C)O[C@@H]2[C@@H](O[C@@]1(C)OC)[C@H](OC(C)=O)C=C1COC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H28O8/c1-10(19)23-12-8-11-9-22-16(2,3)24-13(11)15-14(12)25-17(4,20-6)18(5,21-7)26-15/h8,12-15H,9H2,1-7H3/t12-,13-,14+,15+,17-,18-/m1/s1 |
| InChIKey | JLIXZGWSILYNJT-NUELNUSPSA-N |
| XLogP | 1.52 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|