C27H31NO7S — CID 135013955
[(2R,3S,4S)-5-hydroxyimino-2,3,4-tris(phenylmethoxy)pentyl] methanesulfonate (PubChem CID 135013955) has the molecular formula C27H31NO7S and a molecular weight of 513.61 g/mol. Its IUPAC name is [(2R,3S,4S)-5-hydroxyimino-2,3,4-tris(phenylmethoxy)pentyl] methanesulfonate.
| Compound Name | [(2R,3S,4S)-5-hydroxyimino-2,3,4-tris(phenylmethoxy)pentyl] methanesulfonate |
|---|---|
| PubChem CID | 135013955 |
| Molecular Formula | C27H31NO7S |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | [(2R,3S,4S)-5-hydroxyimino-2,3,4-tris(phenylmethoxy)pentyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](C=NO)OCc1ccccc1 |
| InChI | InChI=1S/C27H31NO7S/c1-36(30,31)35-21-26(33-19-23-13-7-3-8-14-23)27(34-20-24-15-9-4-10-16-24)25(17-28-29)32-18-22-11-5-2-6-12-22/h2-17,25-27,29H,18-21H2,1H3/t25-,26+,27-/m0/s1 |
| InChIKey | JUSJHMYUHXTUIK-VJGNERBWSA-N |
| XLogP | 4.18 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|