C21H38O8Si — CID 135013964
[(2R,3R,4aS,5R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,3-dimethoxy-2,3-dimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-6-yl]methyl acetate (PubChem CID 135013964) has the molecular formula C21H38O8Si and a molecular weight of 446.61 g/mol. Its IUPAC name is [(2R,3R,4aS,5R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,3-dimethoxy-2,3-dimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-6-yl]methyl acetate.
| Compound Name | [(2R,3R,4aS,5R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,3-dimethoxy-2,3-dimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-6-yl]methyl acetate |
|---|---|
| PubChem CID | 135013964 |
| Molecular Formula | C21H38O8Si |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | [(2R,3R,4aS,5R,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,3-dimethoxy-2,3-dimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-6-yl]methyl acetate |
| SMILES | CO[C@]1(C)O[C@@H]2[C@@H](O[C@@]1(C)OC)[C@H](O[Si](C)(C)C(C)(C)C)C=C(COC(C)=O)[C@H]2O |
| InChI | InChI=1S/C21H38O8Si/c1-13(22)26-12-14-11-15(29-30(9,10)19(2,3)4)17-18(16(14)23)28-21(6,25-8)20(5,24-7)27-17/h11,15-18,23H,12H2,1-10H3/t15-,16-,17+,18+,20-,21-/m1/s1 |
| InChIKey | NNOUQYOQTBEXRB-ZQNHQIHDSA-N |
| XLogP | 2.75 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|