C12H14NO2+ — CID 135014096
1-benzyl-5-hydroxy-5-methyl-3,4-dihydropyrrol-3-ylium-2-one (PubChem CID 135014096) has the molecular formula C12H14NO2+ and a molecular weight of 204.25 g/mol. Its IUPAC name is 1-benzyl-5-hydroxy-5-methyl-3,4-dihydropyrrol-3-ylium-2-one.
| Compound Name | 1-benzyl-5-hydroxy-5-methyl-3,4-dihydropyrrol-3-ylium-2-one |
|---|---|
| PubChem CID | 135014096 |
| Molecular Formula | C12H14NO2+ |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-benzyl-5-hydroxy-5-methyl-3,4-dihydropyrrol-3-ylium-2-one |
| SMILES | CC1(O)C[CH+]C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C12H14NO2/c1-12(15)8-7-11(14)13(12)9-10-5-3-2-4-6-10/h2-7,15H,8-9H2,1H3/q+1 |
| InChIKey | DVXHNKUWCZPUGK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|