C26H28NO4+ — CID 135014119
(3R,4R,5R)-1-hydroxy-3,4,5-tris(phenylmethoxy)-2,3,4,5-tetrahydropyridin-1-ium (PubChem CID 135014119) has the molecular formula C26H28NO4+ and a molecular weight of 418.51 g/mol. Its IUPAC name is (3R,4R,5R)-1-hydroxy-3,4,5-tris(phenylmethoxy)-2,3,4,5-tetrahydropyridin-1-ium.
| Compound Name | (3R,4R,5R)-1-hydroxy-3,4,5-tris(phenylmethoxy)-2,3,4,5-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 135014119 |
| Molecular Formula | C26H28NO4+ |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (3R,4R,5R)-1-hydroxy-3,4,5-tris(phenylmethoxy)-2,3,4,5-tetrahydropyridin-1-ium |
| SMILES | O[N+]1=C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C26H28NO4/c28-27-16-24(29-18-21-10-4-1-5-11-21)26(31-20-23-14-8-3-9-15-23)25(17-27)30-19-22-12-6-2-7-13-22/h1-16,24-26,28H,17-20H2/q+1/t24-,25-,26+/m1/s1 |
| InChIKey | PGUNJMAQOJICJT-CYXNTTPDSA-N |
| XLogP | 4.23 |
| TPSA | 50.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|